C13H14N4OS — CID 118739956
pyrimidin-5-yl-[3-(1,3-thiazol-2-yl)piperidin-1-yl]methanone (PubChem CID 118739956) has the molecular formula C13H14N4OS and a molecular weight of 274.35 g/mol. Its IUPAC name is pyrimidin-5-yl-[3-(1,3-thiazol-2-yl)piperidin-1-yl]methanone.
| Compound Name | pyrimidin-5-yl-[3-(1,3-thiazol-2-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 118739956 |
| Molecular Formula | C13H14N4OS |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | pyrimidin-5-yl-[3-(1,3-thiazol-2-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cncnc1)N1CCCC(c2nccs2)C1 |
| InChI | InChI=1S/C13H14N4OS/c18-13(11-6-14-9-15-7-11)17-4-1-2-10(8-17)12-16-3-5-19-12/h3,5-7,9-10H,1-2,4,8H2 |
| InChIKey | GEFSUZQJFUTXGC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |