C13H21N5O — CID 118740010
N,N,1-trimethyl-4-pyrimidin-2-yl-1,4-diazepane-6-carboxamide (PubChem CID 118740010) has the molecular formula C13H21N5O and a molecular weight of 263.34 g/mol. Its IUPAC name is N,N,1-trimethyl-4-pyrimidin-2-yl-1,4-diazepane-6-carboxamide.
| Compound Name | N,N,1-trimethyl-4-pyrimidin-2-yl-1,4-diazepane-6-carboxamide |
|---|---|
| PubChem CID | 118740010 |
| Molecular Formula | C13H21N5O |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | N,N,1-trimethyl-4-pyrimidin-2-yl-1,4-diazepane-6-carboxamide |
| SMILES | CN1CCN(c2ncccn2)CC(C(=O)N(C)C)C1 |
| InChI | InChI=1S/C13H21N5O/c1-16(2)12(19)11-9-17(3)7-8-18(10-11)13-14-5-4-6-15-13/h4-6,11H,7-10H2,1-3H3 |
| InChIKey | PNRYDKWCDGMRJM-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |