About [2-(4,6-dimethylpyrimidin-2-yl)-2-methylpyrrolidin-1-yl]-(1-propylpyrazol-4-yl)methanone
[2-(4,6-dimethylpyrimidin-2-yl)-2-methylpyrrolidin-1-yl]-(1-propylpyrazol-4-yl)methanone (PubChem CID 118740144) has the molecular formula C18H25N5O
and a molecular weight of 327.43 g/mol. Its IUPAC name is [2-(4,6-dimethylpyrimidin-2-yl)-2-methylpyrrolidin-1-yl]-(1-propylpyrazol-4-yl)methanone.
Molecular Properties
| Compound Name | [2-(4,6-dimethylpyrimidin-2-yl)-2-methylpyrrolidin-1-yl]-(1-propylpyrazol-4-yl)methanone |
| PubChem CID | 118740144 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | [2-(4,6-dimethylpyrimidin-2-yl)-2-methylpyrrolidin-1-yl]-(1-propylpyrazol-4-yl)methanone |
| SMILES | CCCn1cc(C(=O)N2CCCC2(C)c2nc(C)cc(C)n2)cn1 |
| InChI | InChI=1S/C18H25N5O/c1-5-8-22-12-15(11-19-22)16(24)23-9-6-7-18(23,4)17-20-13(2)10-14(3)21-17/h10-12H,5-9H2,1-4H3 |
| InChIKey | JWXKJYZSUFTXAL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(4,6-dimethylpyrimidin-2-yl)-2-methylpyrrolidin-1-yl]-(1-propylpyrazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4,6-dimethylpyrimidin-2-yl)-2-methylpyrrolidin-1-yl]-(1-propylpyrazol-4-yl)methanone?
The IUPAC name of [2-(4,6-dimethylpyrimidin-2-yl)-2-methylpyrrolidin-1-yl]-(1-propylpyrazol-4-yl)methanone (CID 118740144) is [2-(4,6-dimethylpyrimidin-2-yl)-2-methylpyrrolidin-1-yl]-(1-propylpyrazol-4-yl)methanone.
What is the SMILES notation for [2-(4,6-dimethylpyrimidin-2-yl)-2-methylpyrrolidin-1-yl]-(1-propylpyrazol-4-yl)methanone?
The canonical SMILES for [2-(4,6-dimethylpyrimidin-2-yl)-2-methylpyrrolidin-1-yl]-(1-propylpyrazol-4-yl)methanone is CCCn1cc(C(=O)N2CCCC2(C)c2nc(C)cc(C)n2)cn1.
What is the InChIKey of [2-(4,6-dimethylpyrimidin-2-yl)-2-methylpyrrolidin-1-yl]-(1-propylpyrazol-4-yl)methanone?
The InChIKey is JWXKJYZSUFTXAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N5O/c1-5-8-22-12-15(11-19-22)16(24)23-9-6-7-18(23,4)17-20-13(2)10-14(3)21-17/h10-12H,5-9H2,1-4H3.
What are the key properties of [2-(4,6-dimethylpyrimidin-2-yl)-2-methylpyrrolidin-1-yl]-(1-propylpyrazol-4-yl)methanone?
[2-(4,6-dimethylpyrimidin-2-yl)-2-methylpyrrolidin-1-yl]-(1-propylpyrazol-4-yl)methanone has a molecular weight of 327.43 g/mol, XLogP of 2.85, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4,6-dimethylpyrimidin-2-yl)-2-methylpyrrolidin-1-yl]-(1-propylpyrazol-4-yl)methanone is sourced from PubChem (CID 118740144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).