C15H14ClN3O4S2 — CID 118740579
(5-chlorothiophen-2-yl)-(1,1-dioxospiro[2,4-dihydropyrido[2,3-b][1,4,5]oxathiazepine-3,3'-pyrrolidine]-1'-yl)methanone (PubChem CID 118740579) has the molecular formula C15H14ClN3O4S2 and a molecular weight of 399.88 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)-(1,1-dioxospiro[2,4-dihydropyrido[2,3-b][1,4,5]oxathiazepine-3,3'-pyrrolidine]-1'-yl)methanone.
| Compound Name | (5-chlorothiophen-2-yl)-(1,1-dioxospiro[2,4-dihydropyrido[2,3-b][1,4,5]oxathiazepine-3,3'-pyrrolidine]-1'-yl)methanone |
|---|---|
| PubChem CID | 118740579 |
| Molecular Formula | C15H14ClN3O4S2 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | (5-chlorothiophen-2-yl)-(1,1-dioxospiro[2,4-dihydropyrido[2,3-b][1,4,5]oxathiazepine-3,3'-pyrrolidine]-1'-yl)methanone |
| SMILES | O=C(c1ccc(Cl)s1)N1CCC2(COc3ncccc3S(=O)(=O)N2)C1 |
| InChI | InChI=1S/C15H14ClN3O4S2/c16-12-4-3-10(24-12)14(20)19-7-5-15(8-19)9-23-13-11(2-1-6-17-13)25(21,22)18-15/h1-4,6,18H,5,7-9H2 |
| InChIKey | OSBLKOSNRNADPK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |