C17H23N3O4S — CID 118740581
cyclohexyl-(1,1-dioxospiro[2,4-dihydropyrido[2,3-b][1,4,5]oxathiazepine-3,3'-pyrrolidine]-1'-yl)methanone (PubChem CID 118740581) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is cyclohexyl-(1,1-dioxospiro[2,4-dihydropyrido[2,3-b][1,4,5]oxathiazepine-3,3'-pyrrolidine]-1'-yl)methanone.
| Compound Name | cyclohexyl-(1,1-dioxospiro[2,4-dihydropyrido[2,3-b][1,4,5]oxathiazepine-3,3'-pyrrolidine]-1'-yl)methanone |
|---|---|
| PubChem CID | 118740581 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | cyclohexyl-(1,1-dioxospiro[2,4-dihydropyrido[2,3-b][1,4,5]oxathiazepine-3,3'-pyrrolidine]-1'-yl)methanone |
| SMILES | O=C(C1CCCCC1)N1CCC2(COc3ncccc3S(=O)(=O)N2)C1 |
| InChI | InChI=1S/C17H23N3O4S/c21-16(13-5-2-1-3-6-13)20-10-8-17(11-20)12-24-15-14(7-4-9-18-15)25(22,23)19-17/h4,7,9,13,19H,1-3,5-6,8,10-12H2 |
| InChIKey | LJGZRJSYRWPYAG-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |