C16H16N4O4S — CID 118740583
(1,1-dioxospiro[2,4-dihydropyrido[2,3-b][1,4,5]oxathiazepine-3,3'-pyrrolidine]-1'-yl)-pyridin-2-ylmethanone (PubChem CID 118740583) has the molecular formula C16H16N4O4S and a molecular weight of 360.39 g/mol. Its IUPAC name is (1,1-dioxospiro[2,4-dihydropyrido[2,3-b][1,4,5]oxathiazepine-3,3'-pyrrolidine]-1'-yl)-pyridin-2-ylmethanone.
| Compound Name | (1,1-dioxospiro[2,4-dihydropyrido[2,3-b][1,4,5]oxathiazepine-3,3'-pyrrolidine]-1'-yl)-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 118740583 |
| Molecular Formula | C16H16N4O4S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | (1,1-dioxospiro[2,4-dihydropyrido[2,3-b][1,4,5]oxathiazepine-3,3'-pyrrolidine]-1'-yl)-pyridin-2-ylmethanone |
| SMILES | O=C(c1ccccn1)N1CCC2(COc3ncccc3S(=O)(=O)N2)C1 |
| InChI | InChI=1S/C16H16N4O4S/c21-15(12-4-1-2-7-17-12)20-9-6-16(10-20)11-24-14-13(5-3-8-18-14)25(22,23)19-16/h1-5,7-8,19H,6,9-11H2 |
| InChIKey | WGHMRQZOHCOHFW-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |