C15H21N3O4S — CID 118740584
1-(1,1-dioxospiro[2,3-dihydropyrido[4,3-b][1,4,5]oxathiazepine-4,3'-pyrrolidine]-1'-yl)-2,2-dimethylpropan-1-one (PubChem CID 118740584) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is 1-(1,1-dioxospiro[2,3-dihydropyrido[4,3-b][1,4,5]oxathiazepine-4,3'-pyrrolidine]-1'-yl)-2,2-dimethylpropan-1-one.
| Compound Name | 1-(1,1-dioxospiro[2,3-dihydropyrido[4,3-b][1,4,5]oxathiazepine-4,3'-pyrrolidine]-1'-yl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 118740584 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 1-(1,1-dioxospiro[2,3-dihydropyrido[4,3-b][1,4,5]oxathiazepine-4,3'-pyrrolidine]-1'-yl)-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)N1CCC2(CNS(=O)(=O)c3cnccc3O2)C1 |
| InChI | InChI=1S/C15H21N3O4S/c1-14(2,3)13(19)18-7-5-15(10-18)9-17-23(20,21)12-8-16-6-4-11(12)22-15/h4,6,8,17H,5,7,9-10H2,1-3H3 |
| InChIKey | HLJSVGMMJDYYBX-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |