C15H16ClN3O3S2 — CID 118740595
1'-[(5-chlorothiophen-2-yl)methyl]spiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,3'-pyrrolidine] 1,1-dioxide (PubChem CID 118740595) has the molecular formula C15H16ClN3O3S2 and a molecular weight of 385.90 g/mol. Its IUPAC name is 1'-[(5-chlorothiophen-2-yl)methyl]spiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,3'-pyrrolidine] 1,1-dioxide.
| Compound Name | 1'-[(5-chlorothiophen-2-yl)methyl]spiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,3'-pyrrolidine] 1,1-dioxide |
|---|---|
| PubChem CID | 118740595 |
| Molecular Formula | C15H16ClN3O3S2 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 1'-[(5-chlorothiophen-2-yl)methyl]spiro[2,3-dihydropyrido[2,3-b][1,4,5]oxathiazepine-4,3'-pyrrolidine] 1,1-dioxide |
| SMILES | O=S1(=O)NCC2(CCN(Cc3ccc(Cl)s3)C2)Oc2ncccc21 |
| InChI | InChI=1S/C15H16ClN3O3S2/c16-13-4-3-11(23-13)8-19-7-5-15(10-19)9-18-24(20,21)12-2-1-6-17-14(12)22-15/h1-4,6,18H,5,7-10H2 |
| InChIKey | HRJROEQRDXMVSK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |