C11H16FNO3S — CID 118740633
2-fluoro-N-(2-hydroxypropyl)-N,4-dimethylbenzenesulfonamide (PubChem CID 118740633) has the molecular formula C11H16FNO3S and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-fluoro-N-(2-hydroxypropyl)-N,4-dimethylbenzenesulfonamide.
| Compound Name | 2-fluoro-N-(2-hydroxypropyl)-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 118740633 |
| Molecular Formula | C11H16FNO3S |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 2-fluoro-N-(2-hydroxypropyl)-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)CC(C)O)c(F)c1 |
| InChI | InChI=1S/C11H16FNO3S/c1-8-4-5-11(10(12)6-8)17(15,16)13(3)7-9(2)14/h4-6,9,14H,7H2,1-3H3 |
| InChIKey | QGXFSDKKQUVWML-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |