About N-cyclopropyl-3-(1,3,5-trimethylpyrazol-4-yl)morpholine-4-carboxamide
N-cyclopropyl-3-(1,3,5-trimethylpyrazol-4-yl)morpholine-4-carboxamide (PubChem CID 118740637) has the molecular formula C14H22N4O2
and a molecular weight of 278.36 g/mol. Its IUPAC name is N-cyclopropyl-3-(1,3,5-trimethylpyrazol-4-yl)morpholine-4-carboxamide.
Molecular Properties
| Compound Name | N-cyclopropyl-3-(1,3,5-trimethylpyrazol-4-yl)morpholine-4-carboxamide |
| PubChem CID | 118740637 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | N-cyclopropyl-3-(1,3,5-trimethylpyrazol-4-yl)morpholine-4-carboxamide |
| SMILES | Cc1nn(C)c(C)c1C1COCCN1C(=O)NC1CC1 |
| InChI | InChI=1S/C14H22N4O2/c1-9-13(10(2)17(3)16-9)12-8-20-7-6-18(12)14(19)15-11-4-5-11/h11-12H,4-8H2,1-3H3,(H,15,19) |
| InChIKey | ROFMBKFFPDVXFM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclopropyl-3-(1,3,5-trimethylpyrazol-4-yl)morpholine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-3-(1,3,5-trimethylpyrazol-4-yl)morpholine-4-carboxamide?
The IUPAC name of N-cyclopropyl-3-(1,3,5-trimethylpyrazol-4-yl)morpholine-4-carboxamide (CID 118740637) is N-cyclopropyl-3-(1,3,5-trimethylpyrazol-4-yl)morpholine-4-carboxamide.
What is the SMILES notation for N-cyclopropyl-3-(1,3,5-trimethylpyrazol-4-yl)morpholine-4-carboxamide?
The canonical SMILES for N-cyclopropyl-3-(1,3,5-trimethylpyrazol-4-yl)morpholine-4-carboxamide is Cc1nn(C)c(C)c1C1COCCN1C(=O)NC1CC1.
What is the InChIKey of N-cyclopropyl-3-(1,3,5-trimethylpyrazol-4-yl)morpholine-4-carboxamide?
The InChIKey is ROFMBKFFPDVXFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4O2/c1-9-13(10(2)17(3)16-9)12-8-20-7-6-18(12)14(19)15-11-4-5-11/h11-12H,4-8H2,1-3H3,(H,15,19).
What are the key properties of N-cyclopropyl-3-(1,3,5-trimethylpyrazol-4-yl)morpholine-4-carboxamide?
N-cyclopropyl-3-(1,3,5-trimethylpyrazol-4-yl)morpholine-4-carboxamide has a molecular weight of 278.36 g/mol, XLogP of 1.28, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-3-(1,3,5-trimethylpyrazol-4-yl)morpholine-4-carboxamide is sourced from PubChem (CID 118740637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).