C15H25N7O — CID 118740808
N',N'-dimethyl-N-[[3-(2-methylpyrazol-3-yl)-4,6,7,8-tetrahydrotriazolo[5,1-c][1,4]oxazepin-7-yl]methyl]ethane-1,2-diamine (PubChem CID 118740808) has the molecular formula C15H25N7O and a molecular weight of 319.41 g/mol. Its IUPAC name is N',N'-dimethyl-N-[[3-(2-methylpyrazol-3-yl)-4,6,7,8-tetrahydrotriazolo[5,1-c][1,4]oxazepin-7-yl]methyl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[[3-(2-methylpyrazol-3-yl)-4,6,7,8-tetrahydrotriazolo[5,1-c][1,4]oxazepin-7-yl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 118740808 |
| Molecular Formula | C15H25N7O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | N',N'-dimethyl-N-[[3-(2-methylpyrazol-3-yl)-4,6,7,8-tetrahydrotriazolo[5,1-c][1,4]oxazepin-7-yl]methyl]ethane-1,2-diamine |
| SMILES | CN(C)CCNCC1COCc2c(-c3ccnn3C)nnn2C1 |
| InChI | InChI=1S/C15H25N7O/c1-20(2)7-6-16-8-12-9-22-14(11-23-10-12)15(18-19-22)13-4-5-17-21(13)3/h4-5,12,16H,6-11H2,1-3H3 |
| InChIKey | CTOYRZANPPBFMN-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 73.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|