C18H27N5O3 — CID 118740816
1-N'-cyclopentyl-6-N-methylspiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-1',6-dicarboxamide (PubChem CID 118740816) has the molecular formula C18H27N5O3 and a molecular weight of 361.45 g/mol. Its IUPAC name is 1-N'-cyclopentyl-6-N-methylspiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-1',6-dicarboxamide.
| Compound Name | 1-N'-cyclopentyl-6-N-methylspiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-1',6-dicarboxamide |
|---|---|
| PubChem CID | 118740816 |
| Molecular Formula | C18H27N5O3 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | 1-N'-cyclopentyl-6-N-methylspiro[5,6-dihydroimidazo[2,1-c][1,4]oxazine-8,4'-piperidine]-1',6-dicarboxamide |
| SMILES | CNC(=O)C1Cn2ccnc2C2(CCN(C(=O)NC3CCCC3)CC2)O1 |
| InChI | InChI=1S/C18H27N5O3/c1-19-15(24)14-12-23-11-8-20-16(23)18(26-14)6-9-22(10-7-18)17(25)21-13-4-2-3-5-13/h8,11,13-14H,2-7,9-10,12H2,1H3,(H,19,24)(H,21,25) |
| InChIKey | ZIXRGXKKESHTTA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |