About 8-pyrimidin-2-yl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane
8-pyrimidin-2-yl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane (PubChem CID 118740969) has the molecular formula C12H18N4O2
and a molecular weight of 250.30 g/mol. Its IUPAC name is 8-pyrimidin-2-yl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane.
Molecular Properties
| Compound Name | 8-pyrimidin-2-yl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane |
| PubChem CID | 118740969 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 8-pyrimidin-2-yl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane |
| SMILES | c1cnc(N2CCOCC3(CNCCO3)C2)nc1 |
| InChI | InChI=1S/C12H18N4O2/c1-2-14-11(15-3-1)16-5-7-17-10-12(9-16)8-13-4-6-18-12/h1-3,13H,4-10H2 |
| InChIKey | USICMJJUULYOAE-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-pyrimidin-2-yl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-pyrimidin-2-yl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane?
The IUPAC name of 8-pyrimidin-2-yl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane (CID 118740969) is 8-pyrimidin-2-yl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane.
What is the SMILES notation for 8-pyrimidin-2-yl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane?
The canonical SMILES for 8-pyrimidin-2-yl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane is c1cnc(N2CCOCC3(CNCCO3)C2)nc1.
What is the InChIKey of 8-pyrimidin-2-yl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane?
The InChIKey is USICMJJUULYOAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4O2/c1-2-14-11(15-3-1)16-5-7-17-10-12(9-16)8-13-4-6-18-12/h1-3,13H,4-10H2.
What are the key properties of 8-pyrimidin-2-yl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane?
8-pyrimidin-2-yl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane has a molecular weight of 250.30 g/mol, XLogP of -0.33, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-pyrimidin-2-yl-1,11-dioxa-4,8-diazaspiro[5.6]dodecane is sourced from PubChem (CID 118740969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).