C16H31N5O — CID 118741108
2-[7-[2-(dimethylamino)ethoxymethyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-N,N-dimethylethanamine (PubChem CID 118741108) has the molecular formula C16H31N5O and a molecular weight of 309.46 g/mol. Its IUPAC name is 2-[7-[2-(dimethylamino)ethoxymethyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[7-[2-(dimethylamino)ethoxymethyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 118741108 |
| Molecular Formula | C16H31N5O |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.25 |
| IUPAC Name | 2-[7-[2-(dimethylamino)ethoxymethyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCOCC1CN(CCN(C)C)Cc2ccnn2C1 |
| InChI | InChI=1S/C16H31N5O/c1-18(2)7-8-20-11-15(14-22-10-9-19(3)4)12-21-16(13-20)5-6-17-21/h5-6,15H,7-14H2,1-4H3 |
| InChIKey | NITJWZFJFQLXQY-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 36.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|