C18H21N3O3 — CID 118741128
(3-pyridin-3-yloxy-1-oxa-8-azaspiro[4.5]decan-8-yl)-(1H-pyrrol-2-yl)methanone (PubChem CID 118741128) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is (3-pyridin-3-yloxy-1-oxa-8-azaspiro[4.5]decan-8-yl)-(1H-pyrrol-2-yl)methanone.
| Compound Name | (3-pyridin-3-yloxy-1-oxa-8-azaspiro[4.5]decan-8-yl)-(1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 118741128 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | (3-pyridin-3-yloxy-1-oxa-8-azaspiro[4.5]decan-8-yl)-(1H-pyrrol-2-yl)methanone |
| SMILES | O=C(c1ccc[nH]1)N1CCC2(CC1)CC(Oc1cccnc1)CO2 |
| InChI | InChI=1S/C18H21N3O3/c22-17(16-4-2-8-20-16)21-9-5-18(6-10-21)11-15(13-23-18)24-14-3-1-7-19-12-14/h1-4,7-8,12,15,20H,5-6,9-11,13H2 |
| InChIKey | SSWJEGOYZSLNHI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |