About 2-propyl-2,9-diazaspiro[4.5]decane-1,3-dione
2-propyl-2,9-diazaspiro[4.5]decane-1,3-dione (PubChem CID 118741624) has the molecular formula C11H18N2O2
and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-propyl-2,9-diazaspiro[4.5]decane-1,3-dione.
Molecular Properties
| Compound Name | 2-propyl-2,9-diazaspiro[4.5]decane-1,3-dione |
| PubChem CID | 118741624 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 2-propyl-2,9-diazaspiro[4.5]decane-1,3-dione |
| SMILES | CCCN1C(=O)CC2(CCCNC2)C1=O |
| InChI | InChI=1S/C11H18N2O2/c1-2-6-13-9(14)7-11(10(13)15)4-3-5-12-8-11/h12H,2-8H2,1H3 |
| InChIKey | KIHMWEMULSIMIP-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-propyl-2,9-diazaspiro[4.5]decane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-2,9-diazaspiro[4.5]decane-1,3-dione?
The IUPAC name of 2-propyl-2,9-diazaspiro[4.5]decane-1,3-dione (CID 118741624) is 2-propyl-2,9-diazaspiro[4.5]decane-1,3-dione.
What is the SMILES notation for 2-propyl-2,9-diazaspiro[4.5]decane-1,3-dione?
The canonical SMILES for 2-propyl-2,9-diazaspiro[4.5]decane-1,3-dione is CCCN1C(=O)CC2(CCCNC2)C1=O.
What is the InChIKey of 2-propyl-2,9-diazaspiro[4.5]decane-1,3-dione?
The InChIKey is KIHMWEMULSIMIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2/c1-2-6-13-9(14)7-11(10(13)15)4-3-5-12-8-11/h12H,2-8H2,1H3.
What are the key properties of 2-propyl-2,9-diazaspiro[4.5]decane-1,3-dione?
2-propyl-2,9-diazaspiro[4.5]decane-1,3-dione has a molecular weight of 210.28 g/mol, XLogP of 0.53, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-2,9-diazaspiro[4.5]decane-1,3-dione is sourced from PubChem (CID 118741624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).