C16H20ClN5OS — CID 118741642
12-[(1,5-dimethylpyrazol-4-yl)methyl]-6-thia-1,8,12-triazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-trien-2-one;hydrochloride (PubChem CID 118741642) has the molecular formula C16H20ClN5OS and a molecular weight of 365.89 g/mol. Its IUPAC name is 12-[(1,5-dimethylpyrazol-4-yl)methyl]-6-thia-1,8,12-triazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-trien-2-one;hydrochloride.
| Compound Name | 12-[(1,5-dimethylpyrazol-4-yl)methyl]-6-thia-1,8,12-triazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-trien-2-one;hydrochloride |
|---|---|
| PubChem CID | 118741642 |
| Molecular Formula | C16H20ClN5OS |
| Molecular Weight | 365.89 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 12-[(1,5-dimethylpyrazol-4-yl)methyl]-6-thia-1,8,12-triazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-trien-2-one;hydrochloride |
| SMILES | Cc1c(CN2CCc3nc4sccc4c(=O)n3CC2)cnn1C.Cl |
| InChI | InChI=1S/C16H19N5OS.ClH/c1-11-12(9-17-19(11)2)10-20-5-3-14-18-15-13(4-8-23-15)16(22)21(14)7-6-20;/h4,8-9H,3,5-7,10H2,1-2H3;1H |
| InChIKey | LPQBPYLYDYKAQE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.89 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |