About 6,7-dimethoxy-3-methyl-2-(2-pyrrolidin-1-ylethylsulfanyl)quinoline;hydrochloride
6,7-dimethoxy-3-methyl-2-(2-pyrrolidin-1-ylethylsulfanyl)quinoline;hydrochloride (PubChem CID 118741857) has the molecular formula C18H25ClN2O2S
and a molecular weight of 368.93 g/mol. Its IUPAC name is 6,7-dimethoxy-3-methyl-2-(2-pyrrolidin-1-ylethylsulfanyl)quinoline;hydrochloride.
Molecular Properties
| Compound Name | 6,7-dimethoxy-3-methyl-2-(2-pyrrolidin-1-ylethylsulfanyl)quinoline;hydrochloride |
| PubChem CID | 118741857 |
| Molecular Formula | C18H25ClN2O2S |
| Molecular Weight | 368.93 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 6,7-dimethoxy-3-methyl-2-(2-pyrrolidin-1-ylethylsulfanyl)quinoline;hydrochloride |
| SMILES | COc1cc2cc(C)c(SCCN3CCCC3)nc2cc1OC.Cl |
| InChI | InChI=1S/C18H24N2O2S.ClH/c1-13-10-14-11-16(21-2)17(22-3)12-15(14)19-18(13)23-9-8-20-6-4-5-7-20;/h10-12H,4-9H2,1-3H3;1H |
| InChIKey | WRERRVGYFLOYBH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.93 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6,7-dimethoxy-3-methyl-2-(2-pyrrolidin-1-ylethylsulfanyl)quinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethoxy-3-methyl-2-(2-pyrrolidin-1-ylethylsulfanyl)quinoline;hydrochloride?
The IUPAC name of 6,7-dimethoxy-3-methyl-2-(2-pyrrolidin-1-ylethylsulfanyl)quinoline;hydrochloride (CID 118741857) is 6,7-dimethoxy-3-methyl-2-(2-pyrrolidin-1-ylethylsulfanyl)quinoline;hydrochloride.
What is the SMILES notation for 6,7-dimethoxy-3-methyl-2-(2-pyrrolidin-1-ylethylsulfanyl)quinoline;hydrochloride?
The canonical SMILES for 6,7-dimethoxy-3-methyl-2-(2-pyrrolidin-1-ylethylsulfanyl)quinoline;hydrochloride is COc1cc2cc(C)c(SCCN3CCCC3)nc2cc1OC.Cl.
What is the InChIKey of 6,7-dimethoxy-3-methyl-2-(2-pyrrolidin-1-ylethylsulfanyl)quinoline;hydrochloride?
The InChIKey is WRERRVGYFLOYBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O2S.ClH/c1-13-10-14-11-16(21-2)17(22-3)12-15(14)19-18(13)23-9-8-20-6-4-5-7-20;/h10-12H,4-9H2,1-3H3;1H.
What are the key properties of 6,7-dimethoxy-3-methyl-2-(2-pyrrolidin-1-ylethylsulfanyl)quinoline;hydrochloride?
6,7-dimethoxy-3-methyl-2-(2-pyrrolidin-1-ylethylsulfanyl)quinoline;hydrochloride has a molecular weight of 368.93 g/mol, XLogP of 4.17, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethoxy-3-methyl-2-(2-pyrrolidin-1-ylethylsulfanyl)quinoline;hydrochloride is sourced from PubChem (CID 118741857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).