C17H22ClN5OS — CID 118741996
12-[(1,5-dimethylpyrazol-4-yl)methyl]-5-methyl-6-thia-1,8,12-triazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-trien-2-one;hydrochloride (PubChem CID 118741996) has the molecular formula C17H22ClN5OS and a molecular weight of 379.92 g/mol. Its IUPAC name is 12-[(1,5-dimethylpyrazol-4-yl)methyl]-5-methyl-6-thia-1,8,12-triazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-trien-2-one;hydrochloride.
| Compound Name | 12-[(1,5-dimethylpyrazol-4-yl)methyl]-5-methyl-6-thia-1,8,12-triazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-trien-2-one;hydrochloride |
|---|---|
| PubChem CID | 118741996 |
| Molecular Formula | C17H22ClN5OS |
| Molecular Weight | 379.92 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 12-[(1,5-dimethylpyrazol-4-yl)methyl]-5-methyl-6-thia-1,8,12-triazatricyclo[7.5.0.03,7]tetradeca-3(7),4,8-trien-2-one;hydrochloride |
| SMILES | Cc1cc2c(=O)n3c(nc2s1)CCN(Cc1cnn(C)c1C)CC3.Cl |
| InChI | InChI=1S/C17H21N5OS.ClH/c1-11-8-14-16(24-11)19-15-4-5-21(6-7-22(15)17(14)23)10-13-9-18-20(3)12(13)2;/h8-9H,4-7,10H2,1-3H3;1H |
| InChIKey | LUVVLMRXYWEAEF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.92 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |