About 2-[(5-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)amino]ethanol
2-[(5-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)amino]ethanol (PubChem CID 118742134) has the molecular formula C16H24N2O
and a molecular weight of 260.38 g/mol. Its IUPAC name is 2-[(5-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[(5-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)amino]ethanol |
| PubChem CID | 118742134 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 2-[(5-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)amino]ethanol |
| SMILES | Cc1ccc2c(c1)C1(CCNCC1)CC2NCCO |
| InChI | InChI=1S/C16H24N2O/c1-12-2-3-13-14(10-12)16(4-6-17-7-5-16)11-15(13)18-8-9-19/h2-3,10,15,17-19H,4-9,11H2,1H3 |
| InChIKey | JYIOLXPBQCZRSJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(5-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)amino]ethanol?
The IUPAC name of 2-[(5-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)amino]ethanol (CID 118742134) is 2-[(5-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)amino]ethanol.
What is the SMILES notation for 2-[(5-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)amino]ethanol?
The canonical SMILES for 2-[(5-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)amino]ethanol is Cc1ccc2c(c1)C1(CCNCC1)CC2NCCO.
What is the InChIKey of 2-[(5-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)amino]ethanol?
The InChIKey is JYIOLXPBQCZRSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O/c1-12-2-3-13-14(10-12)16(4-6-17-7-5-16)11-15(13)18-8-9-19/h2-3,10,15,17-19H,4-9,11H2,1H3.
What are the key properties of 2-[(5-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)amino]ethanol?
2-[(5-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)amino]ethanol has a molecular weight of 260.38 g/mol, XLogP of 1.64, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-methylspiro[1,2-dihydroindene-3,4'-piperidine]-1-yl)amino]ethanol is sourced from PubChem (CID 118742134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).