C18H28F3N5O3 — CID 118742503
N-cyclopentyl-3-[(dimethylamino)methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine-7-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 118742503) has the molecular formula C18H28F3N5O3 and a molecular weight of 419.45 g/mol. Its IUPAC name is N-cyclopentyl-3-[(dimethylamino)methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine-7-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-cyclopentyl-3-[(dimethylamino)methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine-7-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118742503 |
| Molecular Formula | C18H28F3N5O3 |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | N-cyclopentyl-3-[(dimethylamino)methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine-7-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)Cc1cnc2n1CCN(C(=O)NC1CCCC1)CC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H27N5O.C2HF3O2/c1-19(2)12-14-11-17-15-7-8-20(9-10-21(14)15)16(22)18-13-5-3-4-6-13;3-2(4,5)1(6)7/h11,13H,3-10,12H2,1-2H3,(H,18,22);(H,6,7) |
| InChIKey | RRJYMRTTXRWXKP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |