C15H19F3N6O4 — CID 118742626
2-[(5-pyrimidin-2-yl-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl)methoxy]ethanol;2,2,2-trifluoroacetic acid (PubChem CID 118742626) has the molecular formula C15H19F3N6O4 and a molecular weight of 404.35 g/mol. Its IUPAC name is 2-[(5-pyrimidin-2-yl-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl)methoxy]ethanol;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(5-pyrimidin-2-yl-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl)methoxy]ethanol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118742626 |
| Molecular Formula | C15H19F3N6O4 |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 2-[(5-pyrimidin-2-yl-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl)methoxy]ethanol;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.OCCOCc1nnn2c1CN(c1ncccn1)CCC2 |
| InChI | InChI=1S/C13H18N6O2.C2HF3O2/c20-7-8-21-10-11-12-9-18(13-14-3-1-4-15-13)5-2-6-19(12)17-16-11;3-2(4,5)1(6)7/h1,3-4,20H,2,5-10H2;(H,6,7) |
| InChIKey | WYQJSASWJUGTSN-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|