C16H20F3N3O4 — CID 118742652
N,5-bis(cyclopropylmethyl)-4,6-dihydropyrrolo[3,4-d][1,3]oxazole-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 118742652) has the molecular formula C16H20F3N3O4 and a molecular weight of 375.35 g/mol. Its IUPAC name is N,5-bis(cyclopropylmethyl)-4,6-dihydropyrrolo[3,4-d][1,3]oxazole-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N,5-bis(cyclopropylmethyl)-4,6-dihydropyrrolo[3,4-d][1,3]oxazole-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118742652 |
| Molecular Formula | C16H20F3N3O4 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N,5-bis(cyclopropylmethyl)-4,6-dihydropyrrolo[3,4-d][1,3]oxazole-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NCC1CC1)c1nc2c(o1)CN(CC1CC1)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H19N3O2.C2HF3O2/c18-13(15-5-9-1-2-9)14-16-11-7-17(6-10-3-4-10)8-12(11)19-14;3-2(4,5)1(6)7/h9-10H,1-8H2,(H,15,18);(H,6,7) |
| InChIKey | MBNUXWGPFOLHNH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |