C18H27F3N4O3 — CID 118742706
1-(3-methoxypropyl)-8-pyrimidin-2-yl-1,8-diazaspiro[4.5]decane;2,2,2-trifluoroacetic acid (PubChem CID 118742706) has the molecular formula C18H27F3N4O3 and a molecular weight of 404.43 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-8-pyrimidin-2-yl-1,8-diazaspiro[4.5]decane;2,2,2-trifluoroacetic acid.
| Compound Name | 1-(3-methoxypropyl)-8-pyrimidin-2-yl-1,8-diazaspiro[4.5]decane;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118742706 |
| Molecular Formula | C18H27F3N4O3 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 1-(3-methoxypropyl)-8-pyrimidin-2-yl-1,8-diazaspiro[4.5]decane;2,2,2-trifluoroacetic acid |
| SMILES | COCCCN1CCCC12CCN(c1ncccn1)CC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H26N4O.C2HF3O2/c1-21-14-4-11-20-10-2-5-16(20)6-12-19(13-7-16)15-17-8-3-9-18-15;3-2(4,5)1(6)7/h3,8-9H,2,4-7,10-14H2,1H3;(H,6,7) |
| InChIKey | BUYVNHJGELWGRV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|