C18H16F3N5O4S — CID 118743000
N-[(3-pyridin-4-yl-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazin-6-yl)methyl]thiophene-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 118743000) has the molecular formula C18H16F3N5O4S and a molecular weight of 455.42 g/mol. Its IUPAC name is N-[(3-pyridin-4-yl-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazin-6-yl)methyl]thiophene-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(3-pyridin-4-yl-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazin-6-yl)methyl]thiophene-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118743000 |
| Molecular Formula | C18H16F3N5O4S |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | N-[(3-pyridin-4-yl-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazin-6-yl)methyl]thiophene-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NCC1Cn2nnc(-c3ccncc3)c2CO1)c1ccsc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H15N5O2S.C2HF3O2/c22-16(12-3-6-24-10-12)18-7-13-8-21-14(9-23-13)15(19-20-21)11-1-4-17-5-2-11;3-2(4,5)1(6)7/h1-6,10,13H,7-9H2,(H,18,22);(H,6,7) |
| InChIKey | LIQDCEKYRKQZSD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |