C16H18F3N5O5 — CID 118743014
2-methoxy-N-[(3-pyridin-4-yl-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazin-6-yl)methyl]acetamide;2,2,2-trifluoroacetic acid (PubChem CID 118743014) has the molecular formula C16H18F3N5O5 and a molecular weight of 417.34 g/mol. Its IUPAC name is 2-methoxy-N-[(3-pyridin-4-yl-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazin-6-yl)methyl]acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-methoxy-N-[(3-pyridin-4-yl-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazin-6-yl)methyl]acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118743014 |
| Molecular Formula | C16H18F3N5O5 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 2-methoxy-N-[(3-pyridin-4-yl-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazin-6-yl)methyl]acetamide;2,2,2-trifluoroacetic acid |
| SMILES | COCC(=O)NCC1Cn2nnc(-c3ccncc3)c2CO1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H17N5O3.C2HF3O2/c1-21-9-13(20)16-6-11-7-19-12(8-22-11)14(17-18-19)10-2-4-15-5-3-10;3-2(4,5)1(6)7/h2-5,11H,6-9H2,1H3,(H,16,20);(H,6,7) |
| InChIKey | HXJGAKKQHRWSPE-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |