C17H23F3N6O2 — CID 118743090
7-(cyclopentylmethyl)-2-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine;2,2,2-trifluoroacetic acid (PubChem CID 118743090) has the molecular formula C17H23F3N6O2 and a molecular weight of 400.41 g/mol. Its IUPAC name is 7-(cyclopentylmethyl)-2-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine;2,2,2-trifluoroacetic acid.
| Compound Name | 7-(cyclopentylmethyl)-2-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118743090 |
| Molecular Formula | C17H23F3N6O2 |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 7-(cyclopentylmethyl)-2-(1,2,4-triazol-1-ylmethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1ncn(Cc2cn3c(n2)CN(CC2CCCC2)CC3)n1 |
| InChI | InChI=1S/C15H22N6.C2HF3O2/c1-2-4-13(3-1)7-19-5-6-20-8-14(18-15(20)10-19)9-21-12-16-11-17-21;3-2(4,5)1(6)7/h8,11-13H,1-7,9-10H2;(H,6,7) |
| InChIKey | DWPMIWPIQCRZLQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |