C22H26F3N3O4 — CID 118743155
8-(4-methoxyphenyl)-4-pyridin-3-yl-1-oxa-4,8-diazaspiro[5.5]undecane;2,2,2-trifluoroacetic acid (PubChem CID 118743155) has the molecular formula C22H26F3N3O4 and a molecular weight of 453.46 g/mol. Its IUPAC name is 8-(4-methoxyphenyl)-4-pyridin-3-yl-1-oxa-4,8-diazaspiro[5.5]undecane;2,2,2-trifluoroacetic acid.
| Compound Name | 8-(4-methoxyphenyl)-4-pyridin-3-yl-1-oxa-4,8-diazaspiro[5.5]undecane;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118743155 |
| Molecular Formula | C22H26F3N3O4 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 8-(4-methoxyphenyl)-4-pyridin-3-yl-1-oxa-4,8-diazaspiro[5.5]undecane;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(N2CCCC3(C2)CN(c2cccnc2)CCO3)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H25N3O2.C2HF3O2/c1-24-19-7-5-17(6-8-19)22-11-3-9-20(15-22)16-23(12-13-25-20)18-4-2-10-21-14-18;3-2(4,5)1(6)7/h2,4-8,10,14H,3,9,11-13,15-16H2,1H3;(H,6,7) |
| InChIKey | BWEIANADRXINMF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|