C19H24F3N5O3S — CID 118743214
N-[[7-(1,3-thiazol-2-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]cyclobutanecarboxamide;2,2,2-trifluoroacetic acid (PubChem CID 118743214) has the molecular formula C19H24F3N5O3S and a molecular weight of 459.49 g/mol. Its IUPAC name is N-[[7-(1,3-thiazol-2-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]cyclobutanecarboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[7-(1,3-thiazol-2-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]cyclobutanecarboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118743214 |
| Molecular Formula | C19H24F3N5O3S |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | N-[[7-(1,3-thiazol-2-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]cyclobutanecarboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NCc1cnc2n1CCN(Cc1nccs1)CC2)C1CCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H23N5OS.C2HF3O2/c23-17(13-2-1-3-13)20-11-14-10-19-15-4-6-21(7-8-22(14)15)12-16-18-5-9-24-16;3-2(4,5)1(6)7/h5,9-10,13H,1-4,6-8,11-12H2,(H,20,23);(H,6,7) |
| InChIKey | ASVBRPDMJTUNPL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |