C17H26F3N5O3 — CID 118743304
7-ethyl-N,3-dimethylspiro[5,6-dihydroimidazo[1,2-a]pyrazine-8,4'-piperidine]-1'-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 118743304) has the molecular formula C17H26F3N5O3 and a molecular weight of 405.42 g/mol. Its IUPAC name is 7-ethyl-N,3-dimethylspiro[5,6-dihydroimidazo[1,2-a]pyrazine-8,4'-piperidine]-1'-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 7-ethyl-N,3-dimethylspiro[5,6-dihydroimidazo[1,2-a]pyrazine-8,4'-piperidine]-1'-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118743304 |
| Molecular Formula | C17H26F3N5O3 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 7-ethyl-N,3-dimethylspiro[5,6-dihydroimidazo[1,2-a]pyrazine-8,4'-piperidine]-1'-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCN1CCn2c(C)cnc2C12CCN(C(=O)NC)CC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H25N5O.C2HF3O2/c1-4-19-9-10-20-12(2)11-17-13(20)15(19)5-7-18(8-6-15)14(21)16-3;3-2(4,5)1(6)7/h11H,4-10H2,1-3H3,(H,16,21);(H,6,7) |
| InChIKey | JZTDIMULTXKYTN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |