C20H26F3N5O3 — CID 118743337
2-[[8-(cyclopentylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methyl]pyridazin-3-one;2,2,2-trifluoroacetic acid (PubChem CID 118743337) has the molecular formula C20H26F3N5O3 and a molecular weight of 441.45 g/mol. Its IUPAC name is 2-[[8-(cyclopentylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methyl]pyridazin-3-one;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[8-(cyclopentylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methyl]pyridazin-3-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118743337 |
| Molecular Formula | C20H26F3N5O3 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | 2-[[8-(cyclopentylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methyl]pyridazin-3-one;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=c1cccnn1CC1CN(CC2CCCC2)Cc2nccn2C1 |
| InChI | InChI=1S/C18H25N5O.C2HF3O2/c24-18-6-3-7-20-23(18)13-16-11-21(10-15-4-1-2-5-15)14-17-19-8-9-22(17)12-16;3-2(4,5)1(6)7/h3,6-9,15-16H,1-2,4-5,10-14H2;(H,6,7) |
| InChIKey | PSHSHTNEHMHQST-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |