C18H25F3N4O4 — CID 118743551
N-cyclopropyl-1-(2-methoxyethyl)-8-methyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 118743551) has the molecular formula C18H25F3N4O4 and a molecular weight of 418.42 g/mol. Its IUPAC name is N-cyclopropyl-1-(2-methoxyethyl)-8-methyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-cyclopropyl-1-(2-methoxyethyl)-8-methyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118743551 |
| Molecular Formula | C18H25F3N4O4 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | N-cyclopropyl-1-(2-methoxyethyl)-8-methyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COCCN1CCN(C(=O)NC2CC2)Cc2ccc(C)nc21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H24N4O2.C2HF3O2/c1-12-3-4-13-11-20(16(21)18-14-5-6-14)8-7-19(9-10-22-2)15(13)17-12;3-2(4,5)1(6)7/h3-4,14H,5-11H2,1-2H3,(H,18,21);(H,6,7) |
| InChIKey | MTLCPVNCQFLMOA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |