C17H24N4OS — CID 118743597
4-[[6-(cyclopropylmethoxymethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methyl]-2-methyl-1,3-thiazole (PubChem CID 118743597) has the molecular formula C17H24N4OS and a molecular weight of 332.47 g/mol. Its IUPAC name is 4-[[6-(cyclopropylmethoxymethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methyl]-2-methyl-1,3-thiazole.
| Compound Name | 4-[[6-(cyclopropylmethoxymethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 118743597 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 4-[[6-(cyclopropylmethoxymethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]methyl]-2-methyl-1,3-thiazole |
| SMILES | Cc1nc(CN2Cc3nccn3CC(COCC3CC3)C2)cs1 |
| InChI | InChI=1S/C17H24N4OS/c1-13-19-16(12-23-13)8-20-6-15(11-22-10-14-2-3-14)7-21-5-4-18-17(21)9-20/h4-5,12,14-15H,2-3,6-11H2,1H3 |
| InChIKey | SKNRQCHKLXWWII-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |