C16H21F3N4O5S — CID 118743683
N-[[7-(furan-2-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 118743683) has the molecular formula C16H21F3N4O5S and a molecular weight of 438.43 g/mol. Its IUPAC name is N-[[7-(furan-2-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[7-(furan-2-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118743683 |
| Molecular Formula | C16H21F3N4O5S |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | N-[[7-(furan-2-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CS(=O)(=O)NCc1cnc2n1CCN(Cc1ccco1)CC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H20N4O3S.C2HF3O2/c1-22(19,20)16-10-12-9-15-14-4-5-17(6-7-18(12)14)11-13-3-2-8-21-13;3-2(4,5)1(6)7/h2-3,8-9,16H,4-7,10-11H2,1H3;(H,6,7) |
| InChIKey | HGSPMUYSJWLAQL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |