C16H19N7 — CID 118743742
8-(pyridin-2-ylmethyl)-6-(1,2,4-triazol-1-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine (PubChem CID 118743742) has the molecular formula C16H19N7 and a molecular weight of 309.38 g/mol. Its IUPAC name is 8-(pyridin-2-ylmethyl)-6-(1,2,4-triazol-1-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine.
| Compound Name | 8-(pyridin-2-ylmethyl)-6-(1,2,4-triazol-1-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine |
|---|---|
| PubChem CID | 118743742 |
| Molecular Formula | C16H19N7 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 8-(pyridin-2-ylmethyl)-6-(1,2,4-triazol-1-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepine |
| SMILES | c1ccc(CN2Cc3nccn3CC(Cn3cncn3)C2)nc1 |
| InChI | InChI=1S/C16H19N7/c1-2-4-18-15(3-1)10-21-7-14(9-23-13-17-12-20-23)8-22-6-5-19-16(22)11-21/h1-6,12-14H,7-11H2 |
| InChIKey | VIZPRZITKYRZRF-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 64.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |