C17H16N4O5S — CID 11874377
7-(furan-2-yl)-5-[(Z)-2-hydroxy-4-oxopent-2-en-3-yl]sulfanyl-1,3-dimethylpyrimido[4,5-d]pyrimidine-2,4-dione (PubChem CID 11874377) has the molecular formula C17H16N4O5S and a molecular weight of 388.41 g/mol. Its IUPAC name is 7-(furan-2-yl)-5-[(Z)-2-hydroxy-4-oxopent-2-en-3-yl]sulfanyl-1,3-dimethylpyrimido[4,5-d]pyrimidine-2,4-dione.
| Compound Name | 7-(furan-2-yl)-5-[(Z)-2-hydroxy-4-oxopent-2-en-3-yl]sulfanyl-1,3-dimethylpyrimido[4,5-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11874377 |
| Molecular Formula | C17H16N4O5S |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 7-(furan-2-yl)-5-[(Z)-2-hydroxy-4-oxopent-2-en-3-yl]sulfanyl-1,3-dimethylpyrimido[4,5-d]pyrimidine-2,4-dione |
| SMILES | CC(=O)/C(Sc1nc(-c2ccco2)nc2c1c(=O)n(C)c(=O)n2C)=C(\C)O |
| InChI | InChI=1S/C17H16N4O5S/c1-8(22)12(9(2)23)27-15-11-14(20(3)17(25)21(4)16(11)24)18-13(19-15)10-6-5-7-26-10/h5-7,22H,1-4H3/b12-8- |
| InChIKey | AYBBTYKBLUIJKU-WQLSENKSSA-N |
| XLogP | 1.76 |
| TPSA | 120.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|