About 8-[(3,5-dimethylphenyl)methyl]-N-pyrimidin-2-yl-1-oxa-8-azaspiro[4.5]decan-3-amine
8-[(3,5-dimethylphenyl)methyl]-N-pyrimidin-2-yl-1-oxa-8-azaspiro[4.5]decan-3-amine (PubChem CID 118743774) has the molecular formula C21H28N4O
and a molecular weight of 352.48 g/mol. Its IUPAC name is 8-[(3,5-dimethylphenyl)methyl]-N-pyrimidin-2-yl-1-oxa-8-azaspiro[4.5]decan-3-amine.
Molecular Properties
| Compound Name | 8-[(3,5-dimethylphenyl)methyl]-N-pyrimidin-2-yl-1-oxa-8-azaspiro[4.5]decan-3-amine |
| PubChem CID | 118743774 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | 8-[(3,5-dimethylphenyl)methyl]-N-pyrimidin-2-yl-1-oxa-8-azaspiro[4.5]decan-3-amine |
| SMILES | Cc1cc(C)cc(CN2CCC3(CC2)CC(Nc2ncccn2)CO3)c1 |
| InChI | InChI=1S/C21H28N4O/c1-16-10-17(2)12-18(11-16)14-25-8-4-21(5-9-25)13-19(15-26-21)24-20-22-6-3-7-23-20/h3,6-7,10-12,19H,4-5,8-9,13-15H2,1-2H3,(H,22,23,24) |
| InChIKey | PQGKYZCFMLWUOH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-[(3,5-dimethylphenyl)methyl]-N-pyrimidin-2-yl-1-oxa-8-azaspiro[4.5]decan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(3,5-dimethylphenyl)methyl]-N-pyrimidin-2-yl-1-oxa-8-azaspiro[4.5]decan-3-amine?
The IUPAC name of 8-[(3,5-dimethylphenyl)methyl]-N-pyrimidin-2-yl-1-oxa-8-azaspiro[4.5]decan-3-amine (CID 118743774) is 8-[(3,5-dimethylphenyl)methyl]-N-pyrimidin-2-yl-1-oxa-8-azaspiro[4.5]decan-3-amine.
What is the SMILES notation for 8-[(3,5-dimethylphenyl)methyl]-N-pyrimidin-2-yl-1-oxa-8-azaspiro[4.5]decan-3-amine?
The canonical SMILES for 8-[(3,5-dimethylphenyl)methyl]-N-pyrimidin-2-yl-1-oxa-8-azaspiro[4.5]decan-3-amine is Cc1cc(C)cc(CN2CCC3(CC2)CC(Nc2ncccn2)CO3)c1.
What is the InChIKey of 8-[(3,5-dimethylphenyl)methyl]-N-pyrimidin-2-yl-1-oxa-8-azaspiro[4.5]decan-3-amine?
The InChIKey is PQGKYZCFMLWUOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28N4O/c1-16-10-17(2)12-18(11-16)14-25-8-4-21(5-9-25)13-19(15-26-21)24-20-22-6-3-7-23-20/h3,6-7,10-12,19H,4-5,8-9,13-15H2,1-2H3,(H,22,23,24).
What are the key properties of 8-[(3,5-dimethylphenyl)methyl]-N-pyrimidin-2-yl-1-oxa-8-azaspiro[4.5]decan-3-amine?
8-[(3,5-dimethylphenyl)methyl]-N-pyrimidin-2-yl-1-oxa-8-azaspiro[4.5]decan-3-amine has a molecular weight of 352.48 g/mol, XLogP of 3.33, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(3,5-dimethylphenyl)methyl]-N-pyrimidin-2-yl-1-oxa-8-azaspiro[4.5]decan-3-amine is sourced from PubChem (CID 118743774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).