C24H29F3N2O3S — CID 118743828
N,N-dimethyl-2-[1'-(thiophen-3-ylmethyl)spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]acetamide;2,2,2-trifluoroacetic acid (PubChem CID 118743828) has the molecular formula C24H29F3N2O3S and a molecular weight of 482.57 g/mol. Its IUPAC name is N,N-dimethyl-2-[1'-(thiophen-3-ylmethyl)spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N,N-dimethyl-2-[1'-(thiophen-3-ylmethyl)spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118743828 |
| Molecular Formula | C24H29F3N2O3S |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | N,N-dimethyl-2-[1'-(thiophen-3-ylmethyl)spiro[1,2-dihydroindene-3,4'-piperidine]-1-yl]acetamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)CC1CC2(CCN(Cc3ccsc3)CC2)c2ccccc21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H28N2OS.C2HF3O2/c1-23(2)21(25)13-18-14-22(20-6-4-3-5-19(18)20)8-10-24(11-9-22)15-17-7-12-26-16-17;3-2(4,5)1(6)7/h3-7,12,16,18H,8-11,13-15H2,1-2H3;(H,6,7) |
| InChIKey | BLJPUJGXVHUAHH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |