C15H22F3N3O6S2 — CID 118743930
8-methylsulfonyl-4-(1,3-thiazol-2-ylmethyl)-1,11-dioxa-4,8-diazaspiro[5.6]dodecane;2,2,2-trifluoroacetic acid (PubChem CID 118743930) has the molecular formula C15H22F3N3O6S2 and a molecular weight of 461.48 g/mol. Its IUPAC name is 8-methylsulfonyl-4-(1,3-thiazol-2-ylmethyl)-1,11-dioxa-4,8-diazaspiro[5.6]dodecane;2,2,2-trifluoroacetic acid.
| Compound Name | 8-methylsulfonyl-4-(1,3-thiazol-2-ylmethyl)-1,11-dioxa-4,8-diazaspiro[5.6]dodecane;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118743930 |
| Molecular Formula | C15H22F3N3O6S2 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | 8-methylsulfonyl-4-(1,3-thiazol-2-ylmethyl)-1,11-dioxa-4,8-diazaspiro[5.6]dodecane;2,2,2-trifluoroacetic acid |
| SMILES | CS(=O)(=O)N1CCOCC2(CN(Cc3nccs3)CCO2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H21N3O4S2.C2HF3O2/c1-22(17,18)16-4-5-19-11-13(10-16)9-15(3-6-20-13)8-12-14-2-7-21-12;3-2(4,5)1(6)7/h2,7H,3-6,8-11H2,1H3;(H,6,7) |
| InChIKey | ZCUUZBGPRVHFKO-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 109.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |