C17H26F3N5O5S — CID 118743968
2-(dimethylamino)-7-(dimethylsulfamoyl)-N-methyl-5,6,8,9-tetrahydropyrido[2,3-d]azepine-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 118743968) has the molecular formula C17H26F3N5O5S and a molecular weight of 469.49 g/mol. Its IUPAC name is 2-(dimethylamino)-7-(dimethylsulfamoyl)-N-methyl-5,6,8,9-tetrahydropyrido[2,3-d]azepine-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(dimethylamino)-7-(dimethylsulfamoyl)-N-methyl-5,6,8,9-tetrahydropyrido[2,3-d]azepine-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118743968 |
| Molecular Formula | C17H26F3N5O5S |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 2-(dimethylamino)-7-(dimethylsulfamoyl)-N-methyl-5,6,8,9-tetrahydropyrido[2,3-d]azepine-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CNC(=O)c1cc2c(nc1N(C)C)CCN(S(=O)(=O)N(C)C)CC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H25N5O3S.C2HF3O2/c1-16-15(21)12-10-11-6-8-20(24(22,23)19(4)5)9-7-13(11)17-14(12)18(2)3;3-2(4,5)1(6)7/h10H,6-9H2,1-5H3,(H,16,21);(H,6,7) |
| InChIKey | SSCGCJFFJNTRPA-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 123.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |