About [9-(2-phenoxyethyl)-2,9-diazaspiro[4.5]decan-2-yl]-pyrrolidin-1-ylmethanone
[9-(2-phenoxyethyl)-2,9-diazaspiro[4.5]decan-2-yl]-pyrrolidin-1-ylmethanone (PubChem CID 118744011) has the molecular formula C21H31N3O2
and a molecular weight of 357.50 g/mol. Its IUPAC name is [9-(2-phenoxyethyl)-2,9-diazaspiro[4.5]decan-2-yl]-pyrrolidin-1-ylmethanone.
Molecular Properties
| Compound Name | [9-(2-phenoxyethyl)-2,9-diazaspiro[4.5]decan-2-yl]-pyrrolidin-1-ylmethanone |
| PubChem CID | 118744011 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | [9-(2-phenoxyethyl)-2,9-diazaspiro[4.5]decan-2-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(N1CCCC1)N1CCC2(CCCN(CCOc3ccccc3)C2)C1 |
| InChI | InChI=1S/C21H31N3O2/c25-20(23-12-4-5-13-23)24-14-10-21(18-24)9-6-11-22(17-21)15-16-26-19-7-2-1-3-8-19/h1-3,7-8H,4-6,9-18H2 |
| InChIKey | FETHFPJRAKWKPM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [9-(2-phenoxyethyl)-2,9-diazaspiro[4.5]decan-2-yl]-pyrrolidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [9-(2-phenoxyethyl)-2,9-diazaspiro[4.5]decan-2-yl]-pyrrolidin-1-ylmethanone?
The IUPAC name of [9-(2-phenoxyethyl)-2,9-diazaspiro[4.5]decan-2-yl]-pyrrolidin-1-ylmethanone (CID 118744011) is [9-(2-phenoxyethyl)-2,9-diazaspiro[4.5]decan-2-yl]-pyrrolidin-1-ylmethanone.
What is the SMILES notation for [9-(2-phenoxyethyl)-2,9-diazaspiro[4.5]decan-2-yl]-pyrrolidin-1-ylmethanone?
The canonical SMILES for [9-(2-phenoxyethyl)-2,9-diazaspiro[4.5]decan-2-yl]-pyrrolidin-1-ylmethanone is O=C(N1CCCC1)N1CCC2(CCCN(CCOc3ccccc3)C2)C1.
What is the InChIKey of [9-(2-phenoxyethyl)-2,9-diazaspiro[4.5]decan-2-yl]-pyrrolidin-1-ylmethanone?
The InChIKey is FETHFPJRAKWKPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31N3O2/c25-20(23-12-4-5-13-23)24-14-10-21(18-24)9-6-11-22(17-21)15-16-26-19-7-2-1-3-8-19/h1-3,7-8H,4-6,9-18H2.
What are the key properties of [9-(2-phenoxyethyl)-2,9-diazaspiro[4.5]decan-2-yl]-pyrrolidin-1-ylmethanone?
[9-(2-phenoxyethyl)-2,9-diazaspiro[4.5]decan-2-yl]-pyrrolidin-1-ylmethanone has a molecular weight of 357.50 g/mol, XLogP of 3.07, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [9-(2-phenoxyethyl)-2,9-diazaspiro[4.5]decan-2-yl]-pyrrolidin-1-ylmethanone is sourced from PubChem (CID 118744011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).