C20H25F3N4O3S — CID 118744052
N-[[7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]cyclobutanecarboxamide;2,2,2-trifluoroacetic acid (PubChem CID 118744052) has the molecular formula C20H25F3N4O3S and a molecular weight of 458.51 g/mol. Its IUPAC name is N-[[7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]cyclobutanecarboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]cyclobutanecarboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118744052 |
| Molecular Formula | C20H25F3N4O3S |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | N-[[7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]cyclobutanecarboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NCc1cnc2n1CCN(Cc1ccsc1)CC2)C1CCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H24N4OS.C2HF3O2/c23-18(15-2-1-3-15)20-11-16-10-19-17-4-6-21(7-8-22(16)17)12-14-5-9-24-13-14;3-2(4,5)1(6)7/h5,9-10,13,15H,1-4,6-8,11-12H2,(H,20,23);(H,6,7) |
| InChIKey | JWPKJCQWLYJBAN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |