C21H26F3N5O3 — CID 118744098
4-[4-methyl-7-(pyridin-3-ylmethyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-2-yl]morpholine;2,2,2-trifluoroacetic acid (PubChem CID 118744098) has the molecular formula C21H26F3N5O3 and a molecular weight of 453.47 g/mol. Its IUPAC name is 4-[4-methyl-7-(pyridin-3-ylmethyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-2-yl]morpholine;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[4-methyl-7-(pyridin-3-ylmethyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-2-yl]morpholine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118744098 |
| Molecular Formula | C21H26F3N5O3 |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | 4-[4-methyl-7-(pyridin-3-ylmethyl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-2-yl]morpholine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(N2CCOCC2)nc2c1CCN(Cc1cccnc1)CC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H25N5O.C2HF3O2/c1-15-17-4-7-23(14-16-3-2-6-20-13-16)8-5-18(17)22-19(21-15)24-9-11-25-12-10-24;3-2(4,5)1(6)7/h2-3,6,13H,4-5,7-12,14H2,1H3;(H,6,7) |
| InChIKey | WOKFKKMTVWROKH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |