C16H21F3N4O3 — CID 118744148
N-cyclopropyl-1,8-dimethyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 118744148) has the molecular formula C16H21F3N4O3 and a molecular weight of 374.36 g/mol. Its IUPAC name is N-cyclopropyl-1,8-dimethyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-cyclopropyl-1,8-dimethyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118744148 |
| Molecular Formula | C16H21F3N4O3 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | N-cyclopropyl-1,8-dimethyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc2c(n1)N(C)CCN(C(=O)NC1CC1)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H20N4O.C2HF3O2/c1-10-3-4-11-9-18(14(19)16-12-5-6-12)8-7-17(2)13(11)15-10;3-2(4,5)1(6)7/h3-4,12H,5-9H2,1-2H3,(H,16,19);(H,6,7) |
| InChIKey | RTUUIWSHYYEZDA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |