C18H26F3N5O3 — CID 118744150
[4-[ethyl(methyl)amino]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-pyrrolidin-1-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 118744150) has the molecular formula C18H26F3N5O3 and a molecular weight of 417.43 g/mol. Its IUPAC name is [4-[ethyl(methyl)amino]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-pyrrolidin-1-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [4-[ethyl(methyl)amino]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-pyrrolidin-1-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118744150 |
| Molecular Formula | C18H26F3N5O3 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | [4-[ethyl(methyl)amino]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-pyrrolidin-1-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | CCN(C)c1ncnc2c1CCN(C(=O)N1CCCC1)CC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H25N5O.C2HF3O2/c1-3-19(2)15-13-6-10-21(11-7-14(13)17-12-18-15)16(22)20-8-4-5-9-20;3-2(4,5)1(6)7/h12H,3-11H2,1-2H3;(H,6,7) |
| InChIKey | OSZZHCLKYCFDNG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |