C16H21F3N4O4S2 — CID 118744182
N-[[7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 118744182) has the molecular formula C16H21F3N4O4S2 and a molecular weight of 454.50 g/mol. Its IUPAC name is N-[[7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118744182 |
| Molecular Formula | C16H21F3N4O4S2 |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | N-[[7-(thiophen-3-ylmethyl)-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methyl]methanesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CS(=O)(=O)NCc1cnc2n1CCN(Cc1ccsc1)CC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H20N4O2S2.C2HF3O2/c1-22(19,20)16-9-13-8-15-14-2-4-17(5-6-18(13)14)10-12-3-7-21-11-12;3-2(4,5)1(6)7/h3,7-8,11,16H,2,4-6,9-10H2,1H3;(H,6,7) |
| InChIKey | VQQJPWVWQUCKJV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |