C20H25F3N4O4S2 — CID 118744211
5-methyl-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-9-(1,3-thiazol-2-ylmethyl)-1-oxa-4,9-diazaspiro[5.5]undecan-3-one;2,2,2-trifluoroacetic acid (PubChem CID 118744211) has the molecular formula C20H25F3N4O4S2 and a molecular weight of 506.57 g/mol. Its IUPAC name is 5-methyl-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-9-(1,3-thiazol-2-ylmethyl)-1-oxa-4,9-diazaspiro[5.5]undecan-3-one;2,2,2-trifluoroacetic acid.
| Compound Name | 5-methyl-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-9-(1,3-thiazol-2-ylmethyl)-1-oxa-4,9-diazaspiro[5.5]undecan-3-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118744211 |
| Molecular Formula | C20H25F3N4O4S2 |
| Molecular Weight | 506.57 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | 5-methyl-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-9-(1,3-thiazol-2-ylmethyl)-1-oxa-4,9-diazaspiro[5.5]undecan-3-one;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CN2C(=O)COC3(CCN(Cc4nccs4)CC3)C2C)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H24N4O2S2.C2HF3O2/c1-13-18(3-6-21(7-4-18)10-16-19-5-8-25-16)24-11-17(23)22(13)9-15-12-26-14(2)20-15;3-2(4,5)1(6)7/h5,8,12-13H,3-4,6-7,9-11H2,1-2H3;(H,6,7) |
| InChIKey | BPDHRQJOXWNYGT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.57 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |