C18H27F3N4O5S — CID 118744343
9-cyclopropylsulfonyl-2-(diethylaminomethyl)-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-4-one;2,2,2-trifluoroacetic acid (PubChem CID 118744343) has the molecular formula C18H27F3N4O5S and a molecular weight of 468.50 g/mol. Its IUPAC name is 9-cyclopropylsulfonyl-2-(diethylaminomethyl)-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-4-one;2,2,2-trifluoroacetic acid.
| Compound Name | 9-cyclopropylsulfonyl-2-(diethylaminomethyl)-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-4-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118744343 |
| Molecular Formula | C18H27F3N4O5S |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 9-cyclopropylsulfonyl-2-(diethylaminomethyl)-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-4-one;2,2,2-trifluoroacetic acid |
| SMILES | CCN(CC)Cc1cc(=O)n2c(n1)CN(S(=O)(=O)C1CC1)CCC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H26N4O3S.C2HF3O2/c1-3-18(4-2)11-13-10-16(21)20-9-5-8-19(12-15(20)17-13)24(22,23)14-6-7-14;3-2(4,5)1(6)7/h10,14H,3-9,11-12H2,1-2H3;(H,6,7) |
| InChIKey | XAUZEBQUKWFXGQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |