C15H17F3N4O4S — CID 118744366
[7-(methoxymethyl)-1-methyl-5,7-dihydro-4H-pyrazolo[5,4-c]pyridin-6-yl]-(1,3-thiazol-4-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 118744366) has the molecular formula C15H17F3N4O4S and a molecular weight of 406.39 g/mol. Its IUPAC name is [7-(methoxymethyl)-1-methyl-5,7-dihydro-4H-pyrazolo[5,4-c]pyridin-6-yl]-(1,3-thiazol-4-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [7-(methoxymethyl)-1-methyl-5,7-dihydro-4H-pyrazolo[5,4-c]pyridin-6-yl]-(1,3-thiazol-4-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118744366 |
| Molecular Formula | C15H17F3N4O4S |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | [7-(methoxymethyl)-1-methyl-5,7-dihydro-4H-pyrazolo[5,4-c]pyridin-6-yl]-(1,3-thiazol-4-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | COCC1c2c(cnn2C)CCN1C(=O)c1cscn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H16N4O2S.C2HF3O2/c1-16-12-9(5-15-16)3-4-17(11(12)6-19-2)13(18)10-7-20-8-14-10;3-2(4,5)1(6)7/h5,7-8,11H,3-4,6H2,1-2H3;(H,6,7) |
| InChIKey | CFOHRCOTQXHGIG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |