C21H31F3N4O4 — CID 118744568
1-cyclopentyl-3-[1-[2-(dimethylamino)ethyl]-2-oxo-5,6,7,8-tetrahydroquinolin-6-yl]urea;2,2,2-trifluoroacetic acid (PubChem CID 118744568) has the molecular formula C21H31F3N4O4 and a molecular weight of 460.50 g/mol. Its IUPAC name is 1-cyclopentyl-3-[1-[2-(dimethylamino)ethyl]-2-oxo-5,6,7,8-tetrahydroquinolin-6-yl]urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-cyclopentyl-3-[1-[2-(dimethylamino)ethyl]-2-oxo-5,6,7,8-tetrahydroquinolin-6-yl]urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118744568 |
| Molecular Formula | C21H31F3N4O4 |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | 1-cyclopentyl-3-[1-[2-(dimethylamino)ethyl]-2-oxo-5,6,7,8-tetrahydroquinolin-6-yl]urea;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)CCn1c2c(ccc1=O)CC(NC(=O)NC1CCCC1)CC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H30N4O2.C2HF3O2/c1-22(2)11-12-23-17-9-8-16(13-14(17)7-10-18(23)24)21-19(25)20-15-5-3-4-6-15;3-2(4,5)1(6)7/h7,10,15-16H,3-6,8-9,11-13H2,1-2H3,(H2,20,21,25);(H,6,7) |
| InChIKey | JQJQOAGMIZFSMR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 103.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |